C23H26O7 — CID 162820307
[(2R,3S,4R,6R)-3-acetyloxy-6-[[(2R)-6-oxo-2,3-dihydropyran-2-yl]methyl]-2-[(E)-2-phenylethenyl]oxan-4-yl] acetate (PubChem CID 162820307) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3-acetyloxy-6-[[(2R)-6-oxo-2,3-dihydropyran-2-yl]methyl]-2-[(E)-2-phenylethenyl]oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,6R)-3-acetyloxy-6-[[(2R)-6-oxo-2,3-dihydropyran-2-yl]methyl]-2-[(E)-2-phenylethenyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 162820307 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(2R,3S,4R,6R)-3-acetyloxy-6-[[(2R)-6-oxo-2,3-dihydropyran-2-yl]methyl]-2-[(E)-2-phenylethenyl]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](/C=C/c2ccccc2)O[C@H](C[C@H]2CC=CC(=O)O2)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H26O7/c1-15(24)27-21-14-19(13-18-9-6-10-22(26)30-18)29-20(23(21)28-16(2)25)12-11-17-7-4-3-5-8-17/h3-8,10-12,18-21,23H,9,13-14H2,1-2H3/b12-11+/t18-,19-,20-,21-,23-/m1/s1 |
| InChIKey | DNLFPYLWKUTPFH-GJFJUKHVSA-N |
| XLogP | 2.98 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|