C21H31N3O — CID 162820520
1-[5-[(2R,6R,8R,9R,11S,13S)-13-prop-2-enyl-1,7-diazatetracyclo[7.3.1.02,7.06,11]tridecan-8-yl]-3,4-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 162820520) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[5-[(2R,6R,8R,9R,11S,13S)-13-prop-2-enyl-1,7-diazatetracyclo[7.3.1.02,7.06,11]tridecan-8-yl]-3,4-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[5-[(2R,6R,8R,9R,11S,13S)-13-prop-2-enyl-1,7-diazatetracyclo[7.3.1.02,7.06,11]tridecan-8-yl]-3,4-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 162820520 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 1-[5-[(2R,6R,8R,9R,11S,13S)-13-prop-2-enyl-1,7-diazatetracyclo[7.3.1.02,7.06,11]tridecan-8-yl]-3,4-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | C=CC[C@H]1C2C[C@H]3CN1[C@H]1CCC[C@H]3N1[C@H]2C1=CN(C(C)=O)CCC1 |
| InChI | InChI=1S/C21H31N3O/c1-3-6-19-17-11-16-13-23(19)20-9-4-8-18(16)24(20)21(17)15-7-5-10-22(12-15)14(2)25/h3,12,16-21H,1,4-11,13H2,2H3/t16-,17?,18+,19-,20+,21-/m0/s1 |
| InChIKey | XJAWEKIWBWLVGN-OMDWDDMRSA-N |
| XLogP | 2.97 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|