C16H26O2 — CID 162821030
(1S,4S)-6-(hydroxymethyl)-1-methyl-7-methylidene-4-propan-2-yl-2,3,4,4a,8,8a-hexahydronaphthalen-1-ol (PubChem CID 162821030) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1S,4S)-6-(hydroxymethyl)-1-methyl-7-methylidene-4-propan-2-yl-2,3,4,4a,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | (1S,4S)-6-(hydroxymethyl)-1-methyl-7-methylidene-4-propan-2-yl-2,3,4,4a,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 162821030 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1S,4S)-6-(hydroxymethyl)-1-methyl-7-methylidene-4-propan-2-yl-2,3,4,4a,8,8a-hexahydronaphthalen-1-ol |
| SMILES | C=C1CC2C(C=C1CO)[C@H](C(C)C)CC[C@]2(C)O |
| InChI | InChI=1S/C16H26O2/c1-10(2)13-5-6-16(4,18)15-7-11(3)12(9-17)8-14(13)15/h8,10,13-15,17-18H,3,5-7,9H2,1-2,4H3/t13-,14?,15?,16-/m0/s1 |
| InChIKey | FUOFLPVLQDIJPD-LBDPXKHJSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |