C36H48N6O8 — CID 162821098
N-[1-oxo-3-phenyl-1-[(9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]propan-2-yl]hexa-2,4-dienamide (PubChem CID 162821098) has the molecular formula C36H48N6O8 and a molecular weight of 692.81 g/mol. Its IUPAC name is N-[1-oxo-3-phenyl-1-[(9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]propan-2-yl]hexa-2,4-dienamide.
| Compound Name | N-[1-oxo-3-phenyl-1-[(9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]propan-2-yl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 162821098 |
| Molecular Formula | C36H48N6O8 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.35 |
| IUPAC Name | N-[1-oxo-3-phenyl-1-[(9,13,16,17-tetramethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]propan-2-yl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NC(Cc1ccccc1)C(=O)NC1COC(=O)C2CC(C)CN2C(=O)C(C)NC(=O)C(C)N(C)C(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C36H48N6O8/c1-6-7-9-16-30(43)38-26(19-25-13-10-8-11-14-25)32(45)39-27-21-50-36(49)29-18-22(2)20-42(29)33(46)23(3)37-31(44)24(4)40(5)35(48)28-15-12-17-41(28)34(27)47/h6-11,13-14,16,22-24,26-29H,12,15,17-21H2,1-5H3,(H,37,44)(H,38,43)(H,39,45) |
| InChIKey | QSAOHRAWNOMLMA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 174.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|