C38H66O8 — CID 162821565
2-ethyl-6-[[3,4,4,8,10,13-hexamethyl-17-(4,5,6-trihydroxy-6-methylheptan-2-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]oxane-3,4,5-triol (PubChem CID 162821565) has the molecular formula C38H66O8 and a molecular weight of 650.94 g/mol. Its IUPAC name is 2-ethyl-6-[[3,4,4,8,10,13-hexamethyl-17-(4,5,6-trihydroxy-6-methylheptan-2-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-ethyl-6-[[3,4,4,8,10,13-hexamethyl-17-(4,5,6-trihydroxy-6-methylheptan-2-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162821565 |
| Molecular Formula | C38H66O8 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.48 |
| IUPAC Name | 2-ethyl-6-[[3,4,4,8,10,13-hexamethyl-17-(4,5,6-trihydroxy-6-methylheptan-2-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]oxane-3,4,5-triol |
| SMILES | CCC1OC(OC2CC3C(C)(C)C(C)CCC3(C)C3CCC4(C)C(=CCC4C(C)CC(O)C(O)C(C)(C)O)C23C)C(O)C(O)C1O |
| InChI | InChI=1S/C38H66O8/c1-11-24-29(40)30(41)31(42)33(45-24)46-28-19-27-34(4,5)21(3)14-16-37(27,9)26-15-17-36(8)22(12-13-25(36)38(26,28)10)20(2)18-23(39)32(43)35(6,7)44/h13,20-24,26-33,39-44H,11-12,14-19H2,1-10H3 |
| InChIKey | OZNLMUSCHZDBTF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|