C36H48N6O4 — CID 162822325
5-[1-(4-amino-7-methyl-8-oxooctyl)-7-(2-oxoethyl)-1,2,3,4-tetrahydroanthracen-2-yl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pent-2-enoic acid (PubChem CID 162822325) has the molecular formula C36H48N6O4 and a molecular weight of 628.82 g/mol. Its IUPAC name is 5-[1-(4-amino-7-methyl-8-oxooctyl)-7-(2-oxoethyl)-1,2,3,4-tetrahydroanthracen-2-yl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pent-2-enoic acid.
| Compound Name | 5-[1-(4-amino-7-methyl-8-oxooctyl)-7-(2-oxoethyl)-1,2,3,4-tetrahydroanthracen-2-yl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pent-2-enoic acid |
|---|---|
| PubChem CID | 162822325 |
| Molecular Formula | C36H48N6O4 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 5-[1-(4-amino-7-methyl-8-oxooctyl)-7-(2-oxoethyl)-1,2,3,4-tetrahydroanthracen-2-yl]-3-[(diaminomethylideneamino)methyl]-4-(1H-pyrrol-2-ylamino)pent-2-enoic acid |
| SMILES | CC(C=O)CCC(N)CCCC1c2cc3cc(CC=O)ccc3cc2CCC1CC(Nc1ccc[nH]1)C(=CC(=O)O)CN=C(N)N |
| InChI | InChI=1S/C36H48N6O4/c1-23(22-44)7-12-30(37)4-2-5-31-27(11-10-26-17-25-9-8-24(13-15-43)16-28(25)18-32(26)31)19-33(42-34-6-3-14-40-34)29(20-35(45)46)21-41-36(38)39/h3,6,8-9,14-18,20,22-23,27,30-31,33,40,42H,2,4-5,7,10-13,19,21,37H2,1H3,(H,45,46)(H4,38,39,41) |
| InChIKey | VJGTZYPWBPOLQZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 189.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|