C18H17ClO6 — CID 162823133
5-chloro-6,8-dihydroxy-3-[4-[(2S,3R,5R)-3-hydroxy-5-methyloxolan-2-yl]buta-1,3-dienyl]isochromen-1-one (PubChem CID 162823133) has the molecular formula C18H17ClO6 and a molecular weight of 364.78 g/mol. Its IUPAC name is 5-chloro-6,8-dihydroxy-3-[4-[(2S,3R,5R)-3-hydroxy-5-methyloxolan-2-yl]buta-1,3-dienyl]isochromen-1-one.
| Compound Name | 5-chloro-6,8-dihydroxy-3-[4-[(2S,3R,5R)-3-hydroxy-5-methyloxolan-2-yl]buta-1,3-dienyl]isochromen-1-one |
|---|---|
| PubChem CID | 162823133 |
| Molecular Formula | C18H17ClO6 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-chloro-6,8-dihydroxy-3-[4-[(2S,3R,5R)-3-hydroxy-5-methyloxolan-2-yl]buta-1,3-dienyl]isochromen-1-one |
| SMILES | C[C@@H]1C[C@@H](O)[C@H](C=CC=Cc2cc3c(Cl)c(O)cc(O)c3c(=O)o2)O1 |
| InChI | InChI=1S/C18H17ClO6/c1-9-6-12(20)15(24-9)5-3-2-4-10-7-11-16(18(23)25-10)13(21)8-14(22)17(11)19/h2-5,7-9,12,15,20-22H,6H2,1H3/t9-,12-,15+/m1/s1 |
| InChIKey | OQCHWPMKMLHBAH-BCQZVRRWSA-N |
| XLogP | 2.97 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|