About CID 162823442
CID 162823442 (PubChem CID 162823442) has the molecular formula C69H90N2O13
and a molecular weight of 1155.48 g/mol.
Molecular Properties
| Compound Name | CID 162823442 |
| PubChem CID | 162823442 |
| Molecular Formula | C69H90N2O13 |
| Molecular Weight | 1155.48 g/mol |
| Exact Mass | 1154.64 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC4C(O)C5(CCCC5)CC5OC4(CC4C6=C5CC=C6C5(CCCO)COCC6CC78CC4(NNC7CC4(C8)CC7(CCCC7)C7CCCC8CCCC89CCC74C9)C65)C(O)C3O)c2c1O |
| InChI | InChI=1S/C69H90N2O13/c1-36-49(37(2)73)53(75)51-42(52(36)74)24-38(59(79)80)25-45(51)82-60-54(76)56(77)69-27-44-50-41(46(84-69)28-61(15-3-4-16-61)57(78)58(69)83-60)13-14-43(50)66(20-9-23-72)35-81-30-39-26-64-32-65(29-48(64)70-71-68(44,34-64)55(39)66)31-63(17-5-6-18-63)47-12-7-10-40-11-8-19-62(40)21-22-67(47,65)33-62/h14,24-25,39-40,44,46-48,54-58,60,70-72,74-78H,3-13,15-23,26-35H2,1-2H3,(H,79,80) |
| InChIKey | IZOONGUWEHMQDT-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 84 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 1155.48 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 162823442 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162823442?
The IUPAC name of CID 162823442 (CID 162823442) is not available.
What is the SMILES notation for CID 162823442?
The canonical SMILES for CID 162823442 is CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC4C(O)C5(CCCC5)CC5OC4(CC4C6=C5CC=C6C5(CCCO)COCC6CC78CC4(NNC7CC4(C8)CC7(CCCC7)C7CCCC8CCCC89CCC74C9)C65)C(O)C3O)c2c1O.
What is the InChIKey of CID 162823442?
The InChIKey is IZOONGUWEHMQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C69H90N2O13/c1-36-49(37(2)73)53(75)51-42(52(36)74)24-38(59(79)80)25-45(51)82-60-54(76)56(77)69-27-44-50-41(46(84-69)28-61(15-3-4-16-61)57(78)58(69)83-60)13-14-43(50)66(20-9-23-72)35-81-30-39-26-64-32-65(29-48(64)70-71-68(44,34-64)55(39)66)31-63(17-5-6-18-63)47-12-7-10-40-11-8-19-62(40)21-22-67(47,65)33-62/h14,24-25,39-40,44,46-48,54-58,60,70-72,74-78H,3-13,15-23,26-35H2,1-2H3,(H,79,80).
What are the key properties of CID 162823442?
CID 162823442 has a molecular weight of 1155.48 g/mol, XLogP of 9.91, 7 rotatable bonds, 9 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162823442 is sourced from PubChem (CID 162823442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).