C40H56N2O9 — CID 162823446
13-cyclohexyl-12-hydroxy-19-[2-(6-imidazolidin-4-ylhexyl)furan-3-yl]-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione (PubChem CID 162823446) has the molecular formula C40H56N2O9 and a molecular weight of 708.89 g/mol. Its IUPAC name is 13-cyclohexyl-12-hydroxy-19-[2-(6-imidazolidin-4-ylhexyl)furan-3-yl]-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione.
| Compound Name | 13-cyclohexyl-12-hydroxy-19-[2-(6-imidazolidin-4-ylhexyl)furan-3-yl]-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
|---|---|
| PubChem CID | 162823446 |
| Molecular Formula | C40H56N2O9 |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.40 |
| IUPAC Name | 13-cyclohexyl-12-hydroxy-19-[2-(6-imidazolidin-4-ylhexyl)furan-3-yl]-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
| SMILES | CC1(C)OC2CC(=O)OCC23C1C(=O)C(O)C1(C2CCCCC2)C3CCC2(C)C(c3ccoc3CCCCCCC3CNCN3)OC(=O)C3OC321 |
| InChI | InChI=1S/C40H56N2O9/c1-36(2)31-30(44)32(45)39(23-11-7-6-8-12-23)27(38(31)21-48-29(43)19-28(38)50-36)15-17-37(3)33(49-35(46)34-40(37,39)51-34)25-16-18-47-26(25)14-10-5-4-9-13-24-20-41-22-42-24/h16,18,23-24,27-28,31-34,41-42,45H,4-15,17,19-22H2,1-3H3 |
| InChIKey | LHPIIRDZRLBNQO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 148.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|