C34H35N3O10 — CID 162823725
[7-[3-[2-(diaminomethylideneamino)ethoxy]-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyl-9,10-dioxo-1-(2-phenylethenyl)anthracen-2-yl] acetate (PubChem CID 162823725) has the molecular formula C34H35N3O10 and a molecular weight of 645.67 g/mol. Its IUPAC name is [7-[3-[2-(diaminomethylideneamino)ethoxy]-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyl-9,10-dioxo-1-(2-phenylethenyl)anthracen-2-yl] acetate.
| Compound Name | [7-[3-[2-(diaminomethylideneamino)ethoxy]-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyl-9,10-dioxo-1-(2-phenylethenyl)anthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162823725 |
| Molecular Formula | C34H35N3O10 |
| Molecular Weight | 645.67 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | [7-[3-[2-(diaminomethylideneamino)ethoxy]-4,5-dihydroxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyl-9,10-dioxo-1-(2-phenylethenyl)anthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1C=Cc1ccccc1)C(=O)c1cc(OC3OC(C)C(O)C(O)C3OCCN=C(N)N)c(C)c(O)c1C2=O |
| InChI | InChI=1S/C34H35N3O10/c1-16-24(47-33-32(44-14-13-37-34(35)36)31(43)28(40)17(2)45-33)15-22-26(27(16)39)29(41)21-11-12-23(46-18(3)38)20(25(21)30(22)42)10-9-19-7-5-4-6-8-19/h4-12,15,17,28,31-33,39-40,43H,13-14H2,1-3H3,(H4,35,36,37) |
| InChIKey | GRDYXZLXXHPNOL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 213.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|