C73H100N4O9 — CID 162823935
CID 162823935 (PubChem CID 162823935) has the molecular formula C73H100N4O9 and a molecular weight of 1177.62 g/mol.
| Compound Name | CID 162823935 |
|---|---|
| PubChem CID | 162823935 |
| Molecular Formula | C73H100N4O9 |
| Molecular Weight | 1177.62 g/mol |
| Exact Mass | 1176.75 |
| IUPAC Name | — |
| SMILES | CC[C@H]1C[C@H]2C=C[C@@H]1C[C@H](O)C[C@@]1(CCC[C@]13CCO[C@]1(CCC[C@H](CNC)C1)C3)C/N=C(/N)NCC[C@@H]1[C@H]3Oc4cc(ccc4OC#CC[C@@H]3CC3(CCCC3)[C@@H]1CO)[C@@H]1Oc3cc(OC)c4c(c3C[C@H]1O)[C@H]2Cc1cc(O)c(CC(C)C)cc1-4 |
| InChI | InChI=1S/C73H100N4O9/c1-6-46-29-48-15-14-47(46)30-53(79)39-72(22-11-21-71(72)24-27-84-73(42-71)23-9-12-45(37-73)40-75-4)43-77-69(74)76-25-18-54-58(41-78)70(19-7-8-20-70)38-50-13-10-26-83-61-17-16-49(34-63(61)86-67(50)54)68-60(81)35-57-62(85-68)36-64(82-5)66-56-32-52(28-44(2)3)59(80)33-51(56)31-55(48)65(57)66/h14-17,32-34,36,44-48,50,53-55,58,60,67-68,75,78-81H,6-9,11-13,18-25,27-31,35,37-43H2,1-5H3,(H3,74,76,77)/t45-,46-,47+,48+,50+,53-,54-,55-,58+,60+,67-,68-,71+,72-,73-/m0/s1 |
| InChIKey | QAKUDGSSLLRFAA-PQNKPLOXSA-N |
| XLogP | 12.02 |
| TPSA | 189.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 86 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.62 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|