C36H34O13 — CID 162823979
3-[(7-benzyl-23,26,27-trihydroxy-12,13-dimethoxy-2,6,15,25-tetraoxahexacyclo[21.2.2.03,19.05,17.08,16.09,14]heptacosa-3,5(17),9(14),10,12,18-hexaen-20-yn-24-yl)methoxy]-3-oxopropanoic acid (PubChem CID 162823979) has the molecular formula C36H34O13 and a molecular weight of 674.66 g/mol. Its IUPAC name is 3-[(7-benzyl-23,26,27-trihydroxy-12,13-dimethoxy-2,6,15,25-tetraoxahexacyclo[21.2.2.03,19.05,17.08,16.09,14]heptacosa-3,5(17),9(14),10,12,18-hexaen-20-yn-24-yl)methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[(7-benzyl-23,26,27-trihydroxy-12,13-dimethoxy-2,6,15,25-tetraoxahexacyclo[21.2.2.03,19.05,17.08,16.09,14]heptacosa-3,5(17),9(14),10,12,18-hexaen-20-yn-24-yl)methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 162823979 |
| Molecular Formula | C36H34O13 |
| Molecular Weight | 674.66 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | 3-[(7-benzyl-23,26,27-trihydroxy-12,13-dimethoxy-2,6,15,25-tetraoxahexacyclo[21.2.2.03,19.05,17.08,16.09,14]heptacosa-3,5(17),9(14),10,12,18-hexaen-20-yn-24-yl)methoxy]-3-oxopropanoic acid |
| SMILES | COc1ccc2c(c1OC)OC1c3cc4c(cc3OC(Cc3ccccc3)C21)OC1OC(COC(=O)CC(=O)O)C(O)(CC#C4)C(O)C1O |
| InChI | InChI=1S/C36H34O13/c1-43-22-11-10-20-29-25(13-18-7-4-3-5-8-18)46-24-15-23-19(14-21(24)31(29)49-32(20)33(22)44-2)9-6-12-36(42)26(17-45-28(39)16-27(37)38)48-35(47-23)30(40)34(36)41/h3-5,7-8,10-11,14-15,25-26,29-31,34-35,40-42H,12-13,16-17H2,1-2H3,(H,37,38) |
| InChIKey | WEJJGFPPHFUOPS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|