C36H31NO11 — CID 162824456
2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid (PubChem CID 162824456) has the molecular formula C36H31NO11 and a molecular weight of 653.64 g/mol. Its IUPAC name is 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid.
| Compound Name | 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 162824456 |
| Molecular Formula | C36H31NO11 |
| Molecular Weight | 653.64 g/mol |
| Exact Mass | 653.19 |
| IUPAC Name | 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxynaphthalen-1-yl]prop-2-enoyloxy]-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid |
| SMILES | CNCC(c1ccc(O)c(O)c1)C(OC(=O)C=Cc1cc(O)c(O)c2ccc(-c3cc(O)c(O)cc3-c3cccc(O)c3)cc12)C(=O)O |
| InChI | InChI=1S/C36H31NO11/c1-37-17-27(21-6-9-28(39)29(40)13-21)35(36(46)47)48-33(44)10-7-20-14-32(43)34(45)23-8-5-19(12-24(20)23)26-16-31(42)30(41)15-25(26)18-3-2-4-22(38)11-18/h2-16,27,35,37-43,45H,17H2,1H3,(H,46,47) |
| InChIKey | WWXQOFOYBVXCDT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 217.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|