C11H14O4 — CID 162824536
2,3-dimethoxy-5-(2-oxopropyl)cyclohexa-2,4-dien-1-one (PubChem CID 162824536) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(2-oxopropyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 2,3-dimethoxy-5-(2-oxopropyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 162824536 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2,3-dimethoxy-5-(2-oxopropyl)cyclohexa-2,4-dien-1-one |
| SMILES | COC1=C(OC)C(=O)CC(CC(C)=O)=C1 |
| InChI | InChI=1S/C11H14O4/c1-7(12)4-8-5-9(13)11(15-3)10(6-8)14-2/h6H,4-5H2,1-3H3 |
| InChIKey | FKFOMHMBWKFKBR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |