About CID 162824587
CID 162824587 (PubChem CID 162824587) has the molecular formula C48H60N2O13
and a molecular weight of 873.01 g/mol.
Molecular Properties
| Compound Name | CID 162824587 |
| PubChem CID | 162824587 |
| Molecular Formula | C48H60N2O13 |
| Molecular Weight | 873.01 g/mol |
| Exact Mass | 872.41 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCCO)COCC7CC89CC%10(CCCC%10)CC8NNC5(C9)C76)CO4)C(O)C3O)c2c1O |
| InChI | InChI=1S/C48H60N2O13/c1-23-34(24(2)53)38(55)36-28(37(23)54)12-26(42(58)59)13-31(36)62-43-39(56)41(57)48(33(17-52)63-43)15-30-35-25(19-61-48)6-7-29(35)46(10-5-11-51)22-60-18-27-14-45-20-44(8-3-4-9-44)16-32(45)49-50-47(30,21-45)40(27)46/h7,12-13,27,30,32-33,39-41,43,49-52,54-57H,3-6,8-11,14-22H2,1-2H3,(H,58,59) |
| InChIKey | HZFKTTCMFZJERX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 873.01 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 162824587 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162824587?
The IUPAC name of CID 162824587 (CID 162824587) is not available.
What is the SMILES notation for CID 162824587?
The canonical SMILES for CID 162824587 is CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCCO)COCC7CC89CC%10(CCCC%10)CC8NNC5(C9)C76)CO4)C(O)C3O)c2c1O.
What is the InChIKey of CID 162824587?
The InChIKey is HZFKTTCMFZJERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H60N2O13/c1-23-34(24(2)53)38(55)36-28(37(23)54)12-26(42(58)59)13-31(36)62-43-39(56)41(57)48(33(17-52)63-43)15-30-35-25(19-61-48)6-7-29(35)46(10-5-11-51)22-60-18-27-14-45-20-44(8-3-4-9-44)16-32(45)49-50-47(30,21-45)40(27)46/h7,12-13,27,30,32-33,39-41,43,49-52,54-57H,3-6,8-11,14-22H2,1-2H3,(H,58,59).
What are the key properties of CID 162824587?
CID 162824587 has a molecular weight of 873.01 g/mol, XLogP of 4.06, 8 rotatable bonds, 9 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162824587 is sourced from PubChem (CID 162824587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).