C48H60N2O13 — CID 162824588
CID 162824588 (PubChem CID 162824588) has the molecular formula C48H60N2O13 and a molecular weight of 873.01 g/mol.
| Compound Name | CID 162824588 |
|---|---|
| PubChem CID | 162824588 |
| Molecular Formula | C48H60N2O13 |
| Molecular Weight | 873.01 g/mol |
| Exact Mass | 872.41 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(O[C@@H]3O[C@H](CO)[C@]4(C[C@@H]5C6=C(CC=C6[C@@]6(CCCO)COC[C@H]7C[C@]89CC%10(CCCC%10)C[C@H]8NN[C@@]5(C9)[C@@H]76)CO4)[C@H](O)[C@H]3O)c2c1O |
| InChI | InChI=1S/C48H60N2O13/c1-23-34(24(2)53)38(55)36-28(37(23)54)12-26(42(58)59)13-31(36)62-43-39(56)41(57)48(33(17-52)63-43)15-30-35-25(19-61-48)6-7-29(35)46(10-5-11-51)22-60-18-27-14-45-20-44(8-3-4-9-44)16-32(45)49-50-47(30,21-45)40(27)46/h7,12-13,27,30,32-33,39-41,43,49-52,54-57H,3-6,8-11,14-22H2,1-2H3,(H,58,59)/t27-,30-,32-,33-,39-,40+,41-,43-,45-,46-,47-,48-/m1/s1 |
| InChIKey | HZFKTTCMFZJERX-AEASKFKZSA-N |
| XLogP | 4.06 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.01 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|