C27H44O2 — CID 162824626
1-[2-(4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl)ethyl]cyclohexan-1-ol (PubChem CID 162824626) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 1-[2-(4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl)ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-(4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 162824626 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 1-[2-(4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl)ethyl]cyclohexan-1-ol |
| SMILES | C=C1CC2(CCC(CCC3(O)CCCCC3)C2)C2OC2(C)CCC2C1CC2(C)C |
| InChI | InChI=1S/C27H44O2/c1-19-16-26(14-8-20(17-26)9-15-27(28)11-6-5-7-12-27)23-25(4,29-23)13-10-22-21(19)18-24(22,2)3/h20-23,28H,1,5-18H2,2-4H3 |
| InChIKey | CTGZKETZFACDNN-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|