C36H50O12 — CID 162824774
19-[2-[2-(1,2-dihydroxyethyl)-8-hydroxyoctyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione (PubChem CID 162824774) has the molecular formula C36H50O12 and a molecular weight of 674.78 g/mol. Its IUPAC name is 19-[2-[2-(1,2-dihydroxyethyl)-8-hydroxyoctyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione.
| Compound Name | 19-[2-[2-(1,2-dihydroxyethyl)-8-hydroxyoctyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
|---|---|
| PubChem CID | 162824774 |
| Molecular Formula | C36H50O12 |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 19-[2-[2-(1,2-dihydroxyethyl)-8-hydroxyoctyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
| SMILES | CC1(C)OC2CC(=O)OCC23C1C(=O)C(O)C1(C)C3CCC2(C)C(c3ccoc3CC(CCCCCCO)C(O)CO)OC(=O)C3OC321 |
| InChI | InChI=1S/C36H50O12/c1-32(2)27-26(41)28(42)34(4)23(35(27)18-45-25(40)16-24(35)47-32)10-12-33(3)29(46-31(43)30-36(33,34)48-30)20-11-14-44-22(20)15-19(21(39)17-38)9-7-5-6-8-13-37/h11,14,19,21,23-24,27-30,37-39,42H,5-10,12-13,15-18H2,1-4H3 |
| InChIKey | ZDBWCPARFBVHOB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 185.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|