C28H49N3O2 — CID 162824903
1-[2-[(1R,3aS,4S,7S,8aS)-4-cyclohexyl-7-(1-cyclohexylethenyl)-1,4-dihydroxy-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine (PubChem CID 162824903) has the molecular formula C28H49N3O2 and a molecular weight of 459.72 g/mol. Its IUPAC name is 1-[2-[(1R,3aS,4S,7S,8aS)-4-cyclohexyl-7-(1-cyclohexylethenyl)-1,4-dihydroxy-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[(1R,3aS,4S,7S,8aS)-4-cyclohexyl-7-(1-cyclohexylethenyl)-1,4-dihydroxy-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162824903 |
| Molecular Formula | C28H49N3O2 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.38 |
| IUPAC Name | 1-[2-[(1R,3aS,4S,7S,8aS)-4-cyclohexyl-7-(1-cyclohexylethenyl)-1,4-dihydroxy-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
| SMILES | C=C(C1CCCCC1)[C@H]1CC[C@](O)(C2CCCCC2)[C@H]2CC[C@@](O)(CCN/C(N)=N/C)[C@H]2C1 |
| InChI | InChI=1S/C28H49N3O2/c1-20(21-9-5-3-6-10-21)22-13-16-28(33,23-11-7-4-8-12-23)24-14-15-27(32,25(24)19-22)17-18-31-26(29)30-2/h21-25,32-33H,1,3-19H2,2H3,(H3,29,30,31)/t22-,24-,25-,27+,28-/m0/s1 |
| InChIKey | IRXXGCZVLURSTM-SRKPWTSUSA-N |
| XLogP | 4.92 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|