C20H37N3O3 — CID 162824930
1-[2-[1,4-dihydroxy-7-(5-hydroxypent-1-en-2-yl)-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine (PubChem CID 162824930) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is 1-[2-[1,4-dihydroxy-7-(5-hydroxypent-1-en-2-yl)-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[1,4-dihydroxy-7-(5-hydroxypent-1-en-2-yl)-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162824930 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 1-[2-[1,4-dihydroxy-7-(5-hydroxypent-1-en-2-yl)-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
| SMILES | C=C(CCCO)C1CCC(C)(O)C2CCC(O)(CCN/C(N)=N/C)C2C1 |
| InChI | InChI=1S/C20H37N3O3/c1-14(5-4-12-24)15-6-8-19(2,25)16-7-9-20(26,17(16)13-15)10-11-23-18(21)22-3/h15-17,24-26H,1,4-13H2,2-3H3,(H3,21,22,23) |
| InChIKey | CLNFVVYFMAURGO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|