C32H29NO12 — CID 162825156
25,26,27-trihydroxy-5-(3-hydroxyphenyl)-10,11-dimethoxy-2,8,17,28-tetraoxa-20-azaheptacyclo[22.3.1.01,21.03,19.06,18.07,15.09,14]octacosa-3(19),4,6(18),9(14),10,12,22-heptaene-24-carboxylic acid (PubChem CID 162825156) has the molecular formula C32H29NO12 and a molecular weight of 619.58 g/mol. Its IUPAC name is 25,26,27-trihydroxy-5-(3-hydroxyphenyl)-10,11-dimethoxy-2,8,17,28-tetraoxa-20-azaheptacyclo[22.3.1.01,21.03,19.06,18.07,15.09,14]octacosa-3(19),4,6(18),9(14),10,12,22-heptaene-24-carboxylic acid.
| Compound Name | 25,26,27-trihydroxy-5-(3-hydroxyphenyl)-10,11-dimethoxy-2,8,17,28-tetraoxa-20-azaheptacyclo[22.3.1.01,21.03,19.06,18.07,15.09,14]octacosa-3(19),4,6(18),9(14),10,12,22-heptaene-24-carboxylic acid |
|---|---|
| PubChem CID | 162825156 |
| Molecular Formula | C32H29NO12 |
| Molecular Weight | 619.58 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | 25,26,27-trihydroxy-5-(3-hydroxyphenyl)-10,11-dimethoxy-2,8,17,28-tetraoxa-20-azaheptacyclo[22.3.1.01,21.03,19.06,18.07,15.09,14]octacosa-3(19),4,6(18),9(14),10,12,22-heptaene-24-carboxylic acid |
| SMILES | COc1ccc2c(c1OC)OC1c3c(-c4cccc(O)c4)cc4c(c3OCC21)NC1C=CC2(C(=O)O)OC1(O4)C(O)C(O)C2O |
| InChI | InChI=1S/C32H29NO12/c1-40-18-7-6-15-17-12-42-27-21(24(17)43-25(15)26(18)41-2)16(13-4-3-5-14(34)10-13)11-19-22(27)33-20-8-9-31(30(38)39)28(36)23(35)29(37)32(20,44-19)45-31/h3-11,17,20,23-24,28-29,33-37H,12H2,1-2H3,(H,38,39) |
| InChIKey | LQLYWFYATHRVGT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 185.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|