About CID 162825396
CID 162825396 (PubChem CID 162825396) has the molecular formula C60H78N2O13
and a molecular weight of 1035.28 g/mol.
Molecular Properties
| Compound Name | CID 162825396 |
| PubChem CID | 162825396 |
| Molecular Formula | C60H78N2O13 |
| Molecular Weight | 1035.28 g/mol |
| Exact Mass | 1034.55 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCO)COCC7CC89CC5(NNC8CC5(CCCC58CCC5(CCCC5)C8)C9)C76)C5(CCCCC5)O4)C(O)C3O)c2c1O |
| InChI | InChI=1S/C60H78N2O13/c1-32-43(33(2)65)47(67)44-36(46(32)66)21-34(51(70)71)22-40(44)73-52-48(68)50(69)60(42(26-64)74-52)24-39-45-37(9-10-38(45)58(75-60)15-4-3-5-16-58)57(19-20-63)31-72-27-35-23-54-29-56(25-41(54)61-62-59(39,30-54)49(35)57)14-8-13-55(56)18-17-53(28-55)11-6-7-12-53/h9,21-22,35,39,41-42,48-50,52,61-64,66-69H,3-8,10-20,23-31H2,1-2H3,(H,70,71) |
| InChIKey | GIBLKEUZWSPOHS-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 1035.28 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 162825396 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162825396?
The IUPAC name of CID 162825396 (CID 162825396) is not available.
What is the SMILES notation for CID 162825396?
The canonical SMILES for CID 162825396 is CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCO)COCC7CC89CC5(NNC8CC5(CCCC58CCC5(CCCC5)C8)C9)C76)C5(CCCCC5)O4)C(O)C3O)c2c1O.
What is the InChIKey of CID 162825396?
The InChIKey is GIBLKEUZWSPOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H78N2O13/c1-32-43(33(2)65)47(67)44-36(46(32)66)21-34(51(70)71)22-40(44)73-52-48(68)50(69)60(42(26-64)74-52)24-39-45-37(9-10-38(45)58(75-60)15-4-3-5-16-58)57(19-20-63)31-72-27-35-23-54-29-56(25-41(54)61-62-59(39,30-54)49(35)57)14-8-13-55(56)18-17-53(28-55)11-6-7-12-53/h9,21-22,35,39,41-42,48-50,52,61-64,66-69H,3-8,10-20,23-31H2,1-2H3,(H,70,71).
What are the key properties of CID 162825396?
CID 162825396 has a molecular weight of 1035.28 g/mol, XLogP of 7.72, 7 rotatable bonds, 9 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162825396 is sourced from PubChem (CID 162825396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).