C39H65N3O4 — CID 162825549
2-cyclohexyl-1-[[3-[3'-[2-(1,3-dihydroxycyclohexyl)ethyl]-4,12-dimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,1'-cyclopentane]-12-yl]cyclopentyl]-hydroxymethyl]guanidine (PubChem CID 162825549) has the molecular formula C39H65N3O4 and a molecular weight of 639.97 g/mol. Its IUPAC name is 2-cyclohexyl-1-[[3-[3'-[2-(1,3-dihydroxycyclohexyl)ethyl]-4,12-dimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,1'-cyclopentane]-12-yl]cyclopentyl]-hydroxymethyl]guanidine.
| Compound Name | 2-cyclohexyl-1-[[3-[3'-[2-(1,3-dihydroxycyclohexyl)ethyl]-4,12-dimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,1'-cyclopentane]-12-yl]cyclopentyl]-hydroxymethyl]guanidine |
|---|---|
| PubChem CID | 162825549 |
| Molecular Formula | C39H65N3O4 |
| Molecular Weight | 639.97 g/mol |
| Exact Mass | 639.50 |
| IUPAC Name | 2-cyclohexyl-1-[[3-[3'-[2-(1,3-dihydroxycyclohexyl)ethyl]-4,12-dimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,1'-cyclopentane]-12-yl]cyclopentyl]-hydroxymethyl]guanidine |
| SMILES | C=C1CC2(CCC(CCC3(O)CCCC(O)C3)C2)C2OC2(C)CCC2C1CC2(C)C1CCC(C(O)N/C(N)=N/C2CCCCC2)C1 |
| InChI | InChI=1S/C39H65N3O4/c1-25-21-38(18-13-26(22-38)14-19-39(45)16-7-10-30(43)23-39)34-37(3,46-34)17-15-32-31(25)24-36(32,2)28-12-11-27(20-28)33(44)42-35(40)41-29-8-5-4-6-9-29/h26-34,43-45H,1,4-24H2,2-3H3,(H3,40,41,42) |
| InChIKey | CARYTYYYGGXMHH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.97 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|