C20H28O5 — CID 162826275
[3-ethylidene-6-methyl-2-oxo-5-(6-oxoheptan-2-yl)-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] acetate (PubChem CID 162826275) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [3-ethylidene-6-methyl-2-oxo-5-(6-oxoheptan-2-yl)-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] acetate.
| Compound Name | [3-ethylidene-6-methyl-2-oxo-5-(6-oxoheptan-2-yl)-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] acetate |
|---|---|
| PubChem CID | 162826275 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [3-ethylidene-6-methyl-2-oxo-5-(6-oxoheptan-2-yl)-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] acetate |
| SMILES | CC=C1C(=O)OC2CC(C)=C(C(C)CCCC(C)=O)C(OC(C)=O)C12 |
| InChI | InChI=1S/C20H28O5/c1-6-15-18-16(25-20(15)23)10-12(3)17(19(18)24-14(5)22)11(2)8-7-9-13(4)21/h6,11,16,18-19H,7-10H2,1-5H3 |
| InChIKey | UKRMILBDFWSESA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|