C25H24O14 — CID 162826363
3-oxo-3-[[3,4,6-trihydroxy-5-(5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-ylperoxy)oxan-2-yl]methoxy]propanoic acid (PubChem CID 162826363) has the molecular formula C25H24O14 and a molecular weight of 548.45 g/mol. Its IUPAC name is 3-oxo-3-[[3,4,6-trihydroxy-5-(5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-ylperoxy)oxan-2-yl]methoxy]propanoic acid.
| Compound Name | 3-oxo-3-[[3,4,6-trihydroxy-5-(5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-ylperoxy)oxan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 162826363 |
| Molecular Formula | C25H24O14 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 3-oxo-3-[[3,4,6-trihydroxy-5-(5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-15-ylperoxy)oxan-2-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CC(=O)OCC1OC(O)C(OOc2ccc3c(c2)C2Oc4cc5c(cc4C2CO3)OCO5)C(O)C1O |
| InChI | InChI=1S/C25H24O14/c26-19(27)6-20(28)33-8-18-21(29)22(30)24(25(31)37-18)39-38-10-1-2-14-12(3-10)23-13(7-32-14)11-4-16-17(35-9-34-16)5-15(11)36-23/h1-5,13,18,21-25,29-31H,6-9H2,(H,26,27) |
| InChIKey | DQYQDWPWAOPOGI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 188.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|