About 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate
3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate (PubChem CID 162826830) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate |
| PubChem CID | 162826830 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OCCCC1=CCCC=C1 |
| InChI | InChI=1S/C15H24O2/c1-13(2)10-11-15(16)17-12-6-9-14-7-4-3-5-8-14/h4,7-8,13H,3,5-6,9-12H2,1-2H3 |
| InChIKey | ZGKQIZRKXMUOBP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate?
The IUPAC name of 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate (CID 162826830) is 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate is CC(C)CCC(=O)OCCCC1=CCCC=C1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate?
The InChIKey is ZGKQIZRKXMUOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-13(2)10-11-15(16)17-12-6-9-14-7-4-3-5-8-14/h4,7-8,13H,3,5-6,9-12H2,1-2H3.
What are the key properties of 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate?
3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate has a molecular weight of 236.35 g/mol, XLogP of 4.02, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-ylpropyl 4-methylpentanoate is sourced from PubChem (CID 162826830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).