C72H78N4O13 — CID 162827537
CID 162827537 (PubChem CID 162827537) has the molecular formula C72H78N4O13 and a molecular weight of 1207.43 g/mol.
| Compound Name | CID 162827537 |
|---|---|
| PubChem CID | 162827537 |
| Molecular Formula | C72H78N4O13 |
| Molecular Weight | 1207.43 g/mol |
| Exact Mass | 1206.56 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CC5(CC4C=O)NC(C(C)O)CC4CCc6ccc(O)cc6-c6cc7[nH]ccc7n6C45)C4CC(O)CCC4C3C2CC(=O)CC(C(O)Cc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C72H78N4O13/c1-38(79)57-26-41-13-12-40-14-15-44(80)27-50(40)60-33-58-59(19-20-73-58)76(60)70(41)72(75-57)35-43(36-78)71(37-72)34-42-25-54-51-31-63(85)64(87-2)32-52(51)53(68(42)49-17-16-45(81)29-55(49)71)28-46(82)30-66(62(84)23-39-11-18-61(83)65(24-39)88-22-21-77)89-67(86)10-6-4-8-48-47-7-3-5-9-56(47)74-69(48)54/h3,5,7,9,11,14-15,18-20,24-25,27,31-33,36,38,41-43,45,49,53,55,57,62,66,68,70,73-75,77,79-81,83-85H,8,10,12-13,16-17,21-23,26,28-30,34-35,37H2,1-2H3 |
| InChIKey | QVRRWOMCZUHUOT-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 269.05 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 89 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1207.43 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|