C72H78N4O13 — CID 162827566
CID 162827566 (PubChem CID 162827566) has the molecular formula C72H78N4O13 and a molecular weight of 1207.43 g/mol.
| Compound Name | CID 162827566 |
|---|---|
| PubChem CID | 162827566 |
| Molecular Formula | C72H78N4O13 |
| Molecular Weight | 1207.43 g/mol |
| Exact Mass | 1206.56 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CC5(CC4C=O)NC4C(O)CCCC4CC5n4c(-c5cccc(O)c5)cc5[nH]ccc54)C4CC(O)CCC4C3C2CC(=O)CC(C(O)Cc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C72H78N4O13/c1-87-63-33-51-50(32-62(63)85)53-27-42-35-71(38-72(36-43(71)37-78)66(28-41-9-7-14-60(83)69(41)75-72)76-57-20-21-73-56(57)34-58(76)40-8-6-10-44(79)26-40)54-30-45(80)17-18-49(54)68(42)52(51)29-46(81)31-65(61(84)24-39-16-19-59(82)64(25-39)88-23-22-77)89-67(86)15-5-3-12-48-47-11-2-4-13-55(47)74-70(48)53/h2,4,6,8,10-11,13,16,19-21,25-27,32-34,37,41-43,45,49,52,54,60-61,65-66,68-69,73-75,77,79-80,82-85H,7,9,12,14-15,17-18,22-24,28-31,35-36,38H2,1H3 |
| InChIKey | BKRLLWJTUMZSRW-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 269.05 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 89 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1207.43 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|