C71H78N4O11 — CID 162827909
CID 162827909 (PubChem CID 162827909) has the molecular formula C71H78N4O11 and a molecular weight of 1163.42 g/mol.
| Compound Name | CID 162827909 |
|---|---|
| PubChem CID | 162827909 |
| Molecular Formula | C71H78N4O11 |
| Molecular Weight | 1163.42 g/mol |
| Exact Mass | 1162.57 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CCC5(C4)NC4C(O)CCCC4CC5n4c(-c5cccc(O)c5)cc5[nH]ccc54)C4CC(O)CCC4C3C2CC(=O)CC(CCc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C71H78N4O11/c1-84-63-36-52-51(35-62(63)82)54-30-43-38-70(23-24-71(39-70)65(31-42-9-7-14-61(81)68(42)74-71)75-58-22-25-72-57(58)37-59(75)41-8-6-10-44(77)29-41)55-34-45(78)18-20-50(55)67(43)53(52)33-46(79)32-47(19-16-40-17-21-60(80)64(28-40)85-27-26-76)86-66(83)15-5-3-12-49-48-11-2-4-13-56(48)73-69(49)54/h2,4,6,8,10-11,13,17,21-22,25,28-30,35-37,42-43,45,47,50,53,55,61,65,67-68,72-74,76-78,80-82H,7,9,12,14-16,18-20,23-24,26-27,31-34,38-39H2,1H3 |
| InChIKey | RPWPMOGQZQMJHG-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 231.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 86 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.42 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|