C41H38N2O12 — CID 162828148
[6-[[3-(diaminomethyl)phenyl]methyl]-5-hydroxy-4-(hydroxymethyl)-1-naphthalen-2-yl-9,10-dioxo-7-(3,4,4,5-tetrahydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate (PubChem CID 162828148) has the molecular formula C41H38N2O12 and a molecular weight of 750.76 g/mol. Its IUPAC name is [6-[[3-(diaminomethyl)phenyl]methyl]-5-hydroxy-4-(hydroxymethyl)-1-naphthalen-2-yl-9,10-dioxo-7-(3,4,4,5-tetrahydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate.
| Compound Name | [6-[[3-(diaminomethyl)phenyl]methyl]-5-hydroxy-4-(hydroxymethyl)-1-naphthalen-2-yl-9,10-dioxo-7-(3,4,4,5-tetrahydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate |
|---|---|
| PubChem CID | 162828148 |
| Molecular Formula | C41H38N2O12 |
| Molecular Weight | 750.76 g/mol |
| Exact Mass | 750.24 |
| IUPAC Name | [6-[[3-(diaminomethyl)phenyl]methyl]-5-hydroxy-4-(hydroxymethyl)-1-naphthalen-2-yl-9,10-dioxo-7-(3,4,4,5-tetrahydroxy-6-methyloxan-2-yl)oxyanthracen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc(CO)c2c(c1-c1ccc3ccccc3c1)C(=O)c1cc(OC3OC(C)C(O)C(O)(O)C3O)c(Cc3cccc(C(N)N)c3)c(O)c1C2=O |
| InChI | InChI=1S/C41H38N2O12/c1-18-37(49)41(51,52)38(50)40(53-18)55-28-16-27-32(34(46)26(28)13-20-6-5-9-24(12-20)39(42)43)36(48)31-25(17-44)15-29(54-19(2)45)30(33(31)35(27)47)23-11-10-21-7-3-4-8-22(21)14-23/h3-12,14-16,18,37-40,44,46,49-52H,13,17,42-43H2,1-2H3 |
| InChIKey | HYGCANQQUOUYHQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|