C22H35NO8 — CID 162828448
(1R,2R,3S,4S,5R,6R,8S,9R,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,9,13,14,16-hexol (PubChem CID 162828448) has the molecular formula C22H35NO8 and a molecular weight of 441.52 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R,6R,8S,9R,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,9,13,14,16-hexol.
| Compound Name | (1R,2R,3S,4S,5R,6R,8S,9R,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,9,13,14,16-hexol |
|---|---|
| PubChem CID | 162828448 |
| Molecular Formula | C22H35NO8 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (1R,2R,3S,4S,5R,6R,8S,9R,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,9,13,14,16-hexol |
| SMILES | CCN1C[C@]2(O)[C@H](O)C[C@H](O)[C@@]34[C@@H]2C[C@@](O)([C@@H]13)[C@@]1(O)C[C@@H](OC)[C@H]2C[C@H]4[C@]1(O)[C@H]2OC |
| InChI | InChI=1S/C22H35NO8/c1-4-23-9-18(26)13-8-19(27)17(23)21(13,15(25)6-14(18)24)12-5-10-11(30-2)7-20(19,28)22(12,29)16(10)31-3/h10-17,24-29H,4-9H2,1-3H3/t10-,11-,12-,13-,14-,15+,16+,17-,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | YLPLJXCDPFFWJQ-YAADGGAQSA-N |
| XLogP | -2.17 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |