C39H50N4O3 — CID 162828546
2-methyl-1-[11',12',20'-trihydroxy-2'-(1H-indol-2-ylmethyl)spiro[cyclopentane-1,4'-hexacyclo[14.8.0.01,6.011,15.014,20.019,24]tetracos-2-en-7-yne]-9'-yl]guanidine (PubChem CID 162828546) has the molecular formula C39H50N4O3 and a molecular weight of 622.85 g/mol. Its IUPAC name is 2-methyl-1-[11',12',20'-trihydroxy-2'-(1H-indol-2-ylmethyl)spiro[cyclopentane-1,4'-hexacyclo[14.8.0.01,6.011,15.014,20.019,24]tetracos-2-en-7-yne]-9'-yl]guanidine.
| Compound Name | 2-methyl-1-[11',12',20'-trihydroxy-2'-(1H-indol-2-ylmethyl)spiro[cyclopentane-1,4'-hexacyclo[14.8.0.01,6.011,15.014,20.019,24]tetracos-2-en-7-yne]-9'-yl]guanidine |
|---|---|
| PubChem CID | 162828546 |
| Molecular Formula | C39H50N4O3 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | 2-methyl-1-[11',12',20'-trihydroxy-2'-(1H-indol-2-ylmethyl)spiro[cyclopentane-1,4'-hexacyclo[14.8.0.01,6.011,15.014,20.019,24]tetracos-2-en-7-yne]-9'-yl]guanidine |
| SMILES | C/N=C(\N)NC1C#CC2CC3(C=C(Cc4cc5ccccc5[nH]4)C24C2CCCC5(O)C6CC(O)C(O)(C1)C6C4CCC25)CCCC3 |
| InChI | InChI=1S/C39H50N4O3/c1-41-35(40)43-26-11-10-24-20-36(14-4-5-15-36)21-25(18-27-17-23-7-2-3-9-32(23)42-27)39(24)29-8-6-16-37(45)28(29)12-13-30(39)34-31(37)19-33(44)38(34,46)22-26/h2-3,7,9,17,21,24,26,28-31,33-34,42,44-46H,4-6,8,12-16,18-20,22H2,1H3,(H3,40,41,43) |
| InChIKey | UMUDJAZQRGBVCW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|