C28H47NO2 — CID 162828728
(1R,2R,4R,6S,8R,9S,14R,16R,17S,19S)-19-methyl-6-pentyl-10-azahexacyclo[17.3.1.02,16.04,8.04,16.09,14]tricosane-1,17-diol (PubChem CID 162828728) has the molecular formula C28H47NO2 and a molecular weight of 429.69 g/mol. Its IUPAC name is (1R,2R,4R,6S,8R,9S,14R,16R,17S,19S)-19-methyl-6-pentyl-10-azahexacyclo[17.3.1.02,16.04,8.04,16.09,14]tricosane-1,17-diol.
| Compound Name | (1R,2R,4R,6S,8R,9S,14R,16R,17S,19S)-19-methyl-6-pentyl-10-azahexacyclo[17.3.1.02,16.04,8.04,16.09,14]tricosane-1,17-diol |
|---|---|
| PubChem CID | 162828728 |
| Molecular Formula | C28H47NO2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | (1R,2R,4R,6S,8R,9S,14R,16R,17S,19S)-19-methyl-6-pentyl-10-azahexacyclo[17.3.1.02,16.04,8.04,16.09,14]tricosane-1,17-diol |
| SMILES | CCCCC[C@H]1C[C@H]2[C@H]3NCCC[C@@H]3C[C@@]34[C@@H](O)C[C@]5(C)CCC[C@@](O)(C5)[C@@H]3C[C@]24C1 |
| InChI | InChI=1S/C28H47NO2/c1-3-4-5-8-19-13-21-24-20(9-6-12-29-24)15-28-22(16-26(21,28)14-19)27(31)11-7-10-25(2,18-27)17-23(28)30/h19-24,29-31H,3-18H2,1-2H3/t19-,20+,21-,22-,23-,24-,25-,26+,27+,28-/m0/s1 |
| InChIKey | DHPRFXRUFQVKLG-IQGRAYCCSA-N |
| XLogP | 5.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|