C30H38O5 — CID 162828862
19-benzyl-6,15-dihydroxy-10,17-dimethyl-16-methylidene-2-oxatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione (PubChem CID 162828862) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is 19-benzyl-6,15-dihydroxy-10,17-dimethyl-16-methylidene-2-oxatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione.
| Compound Name | 19-benzyl-6,15-dihydroxy-10,17-dimethyl-16-methylidene-2-oxatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione |
|---|---|
| PubChem CID | 162828862 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 19-benzyl-6,15-dihydroxy-10,17-dimethyl-16-methylidene-2-oxatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione |
| SMILES | C=C1C(C)C2C(Cc3ccccc3)CC(=O)C23OC(=O)C=CC(O)CCCC(C)CC=CC3C1O |
| InChI | InChI=1S/C30H38O5/c1-19-9-7-13-24(31)15-16-27(33)35-30-25(14-8-10-19)29(34)21(3)20(2)28(30)23(18-26(30)32)17-22-11-5-4-6-12-22/h4-6,8,11-12,14-16,19-20,23-25,28-29,31,34H,3,7,9-10,13,17-18H2,1-2H3 |
| InChIKey | JENNZALRPUAJST-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|