C28H30O8 — CID 162829232
(3R,4S)-3-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9-diol (PubChem CID 162829232) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is (3R,4S)-3-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9-diol.
| Compound Name | (3R,4S)-3-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9-diol |
|---|---|
| PubChem CID | 162829232 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (3R,4S)-3-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9-diol |
| SMILES | COc1cc([C@@H]2COc3ccc4c(c3[C@H]2O)CCc2c(OC)cc(O)cc2-4)cc(OCCCO)c1O |
| InChI | InChI=1S/C28H30O8/c1-33-23-13-16(30)12-20-17-6-7-22-26(19(17)5-4-18(20)23)27(31)21(14-36-22)15-10-24(34-2)28(32)25(11-15)35-9-3-8-29/h6-7,10-13,21,27,29-32H,3-5,8-9,14H2,1-2H3/t21-,27-/m0/s1 |
| InChIKey | RBAAMXJGXCIJQM-IDISGSTGSA-N |
| XLogP | 3.85 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|