C36H48N4O4 — CID 162829646
1-(3-hydroxypropyl)-2-methyl-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine (PubChem CID 162829646) has the molecular formula C36H48N4O4 and a molecular weight of 600.80 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-2-methyl-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine.
| Compound Name | 1-(3-hydroxypropyl)-2-methyl-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine |
|---|---|
| PubChem CID | 162829646 |
| Molecular Formula | C36H48N4O4 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | 1-(3-hydroxypropyl)-2-methyl-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine |
| SMILES | C/N=C(\NCCCO)NC1C#CC2CCC=C(Cc3cc4ccccc4[nH]3)C23CC2CCC3C3C(CC(O)C3(O)C1)C2(C)O |
| InChI | InChI=1S/C36H48N4O4/c1-34(43)25-12-14-28-32-29(34)19-31(42)36(32,44)21-26(40-33(37-2)38-15-6-16-41)13-11-23-8-5-9-24(35(23,28)20-25)18-27-17-22-7-3-4-10-30(22)39-27/h3-4,7,9-10,17,23,25-26,28-29,31-32,39,41-44H,5-6,8,12,14-16,18-21H2,1-2H3,(H2,37,38,40) |
| InChIKey | OKJBKXLLBRQEEK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|