C32H54O15 — CID 162830498
2-[2-[1-hydroperoxy-2,4b,8,8-tetramethyl-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-yl]-2-hydroxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162830498) has the molecular formula C32H54O15 and a molecular weight of 678.77 g/mol. Its IUPAC name is 2-[2-[1-hydroperoxy-2,4b,8,8-tetramethyl-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-yl]-2-hydroxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[2-[1-hydroperoxy-2,4b,8,8-tetramethyl-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-yl]-2-hydroxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162830498 |
| Molecular Formula | C32H54O15 |
| Molecular Weight | 678.77 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | 2-[2-[1-hydroperoxy-2,4b,8,8-tetramethyl-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-yl]-2-hydroxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1(C)C(OC2OC(CO)C(O)C(O)C2O)CCC2(C)C3CCC(C)(C(O)COC4OC(CO)C(O)C(O)C4O)C(OO)C3=CCC12 |
| InChI | InChI=1S/C32H54O15/c1-30(2)18-6-5-14-15(31(18,3)10-8-20(30)46-29-26(41)24(39)22(37)17(12-34)45-29)7-9-32(4,27(14)47-42)19(35)13-43-28-25(40)23(38)21(36)16(11-33)44-28/h5,15-29,33-42H,6-13H2,1-4H3 |
| InChIKey | DTUGRIDREWTHOH-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 248.45 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.77 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|