C20H30F2N4O4 — CID 162830513
2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide (PubChem CID 162830513) has the molecular formula C20H30F2N4O4 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide.
| Compound Name | 2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 162830513 |
| Molecular Formula | C20H30F2N4O4 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide |
| SMILES | Cn1ccnc1CNC(=O)CC1CC2OC(CNC3CCC(F)(F)CC3)C(O)C2O1 |
| InChI | InChI=1S/C20H30F2N4O4/c1-26-7-6-23-16(26)11-25-17(27)9-13-8-14-19(29-13)18(28)15(30-14)10-24-12-2-4-20(21,22)5-3-12/h6-7,12-15,18-19,24,28H,2-5,8-11H2,1H3,(H,25,27) |
| InChIKey | NJRLPVWYNTYVGX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |