C31H46O4 — CID 162832186
6-(3-hydroxy-4,4,10,13,14-pentamethyl-11-methylidene-7-oxo-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid (PubChem CID 162832186) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 6-(3-hydroxy-4,4,10,13,14-pentamethyl-11-methylidene-7-oxo-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid.
| Compound Name | 6-(3-hydroxy-4,4,10,13,14-pentamethyl-11-methylidene-7-oxo-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 162832186 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 6-(3-hydroxy-4,4,10,13,14-pentamethyl-11-methylidene-7-oxo-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
| SMILES | C=C1CC2(C)C(C(C)CCC=C(C)C(=O)O)CCC2(C)C2=C1C1(C)CCC(O)C(C)(C)C1CC2=O |
| InChI | InChI=1S/C31H46O4/c1-18(10-9-11-19(2)27(34)35)21-12-15-30(7)26-22(32)16-23-28(4,5)24(33)13-14-29(23,6)25(26)20(3)17-31(21,30)8/h11,18,21,23-24,33H,3,9-10,12-17H2,1-2,4-8H3,(H,34,35) |
| InChIKey | IUTKRBDYMYZMHC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|