C24H38O2 — CID 162832328
3-[(1R,1'R,3R,5S,6S,9S,11S,15R)-3,11-dimethyl-8-methylidenespiro[4-oxatetracyclo[7.5.1.03,5.011,15]pentadecane-6,3'-cyclopentane]-1'-yl]propan-1-ol (PubChem CID 162832328) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 3-[(1R,1'R,3R,5S,6S,9S,11S,15R)-3,11-dimethyl-8-methylidenespiro[4-oxatetracyclo[7.5.1.03,5.011,15]pentadecane-6,3'-cyclopentane]-1'-yl]propan-1-ol.
| Compound Name | 3-[(1R,1'R,3R,5S,6S,9S,11S,15R)-3,11-dimethyl-8-methylidenespiro[4-oxatetracyclo[7.5.1.03,5.011,15]pentadecane-6,3'-cyclopentane]-1'-yl]propan-1-ol |
|---|---|
| PubChem CID | 162832328 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 3-[(1R,1'R,3R,5S,6S,9S,11S,15R)-3,11-dimethyl-8-methylidenespiro[4-oxatetracyclo[7.5.1.03,5.011,15]pentadecane-6,3'-cyclopentane]-1'-yl]propan-1-ol |
| SMILES | C=C1C[C@@]2(CC[C@H](CCCO)C2)[C@@H]2O[C@]2(C)C[C@H]2CCC[C@@]3(C)C[C@H]1[C@@H]23 |
| InChI | InChI=1S/C24H38O2/c1-16-12-24(10-8-17(13-24)6-5-11-25)21-23(3,26-21)14-18-7-4-9-22(2)15-19(16)20(18)22/h17-21,25H,1,4-15H2,2-3H3/t17-,18+,19+,20+,21+,22-,23+,24+/m0/s1 |
| InChIKey | LOMCSNMWUADCBX-KBUDFMHNSA-N |
| XLogP | 5.50 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|