C53H84O6 — CID 162832471
14-(5-cyclohexylpentyl)-21-hydroxy-18-(hydroxymethyl)-23-[[4-(2-methoxyethyl)phenyl]methyl]-5,8,11,17-tetramethyl-24-propyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid (PubChem CID 162832471) has the molecular formula C53H84O6 and a molecular weight of 817.25 g/mol. Its IUPAC name is 14-(5-cyclohexylpentyl)-21-hydroxy-18-(hydroxymethyl)-23-[[4-(2-methoxyethyl)phenyl]methyl]-5,8,11,17-tetramethyl-24-propyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid.
| Compound Name | 14-(5-cyclohexylpentyl)-21-hydroxy-18-(hydroxymethyl)-23-[[4-(2-methoxyethyl)phenyl]methyl]-5,8,11,17-tetramethyl-24-propyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid |
|---|---|
| PubChem CID | 162832471 |
| Molecular Formula | C53H84O6 |
| Molecular Weight | 817.25 g/mol |
| Exact Mass | 816.63 |
| IUPAC Name | 14-(5-cyclohexylpentyl)-21-hydroxy-18-(hydroxymethyl)-23-[[4-(2-methoxyethyl)phenyl]methyl]-5,8,11,17-tetramethyl-24-propyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracosane-11-carboxylic acid |
| SMILES | CCCC1C2(O)CCC3(CO)C4(C)CCC5(CCCCCC6CCCCC6)C6CC(C)(C(=O)O)CCC6(C)CCC5(C)C4CCC13C(Cc1ccc(CCOC)cc1)O2 |
| InChI | InChI=1S/C53H84O6/c1-7-14-42-52-25-22-41-48(4)29-28-46(2)26-27-47(3,45(55)56)36-43(46)50(48,24-13-9-12-17-38-15-10-8-11-16-38)31-30-49(41,5)51(52,37-54)32-33-53(42,57)59-44(52)35-40-20-18-39(19-21-40)23-34-58-6/h18-21,38,41-44,54,57H,7-17,22-37H2,1-6H3,(H,55,56) |
| InChIKey | XXLWSTYGKARIDK-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.25 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|