C36H44O7 — CID 162833284
2-(3-cyclohexyloxy-4-hydroxy-5-methoxyphenyl)-11-methoxy-4-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 162833284) has the molecular formula C36H44O7 and a molecular weight of 588.74 g/mol. Its IUPAC name is 2-(3-cyclohexyloxy-4-hydroxy-5-methoxyphenyl)-11-methoxy-4-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | 2-(3-cyclohexyloxy-4-hydroxy-5-methoxyphenyl)-11-methoxy-4-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 162833284 |
| Molecular Formula | C36H44O7 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 2-(3-cyclohexyloxy-4-hydroxy-5-methoxyphenyl)-11-methoxy-4-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | CCCCCC1c2c(cc(OC)c3c2CCc2cc(O)ccc2-3)OC(c2cc(OC)c(O)c(OC3CCCCC3)c2)C1O |
| InChI | InChI=1S/C36H44O7/c1-4-5-7-12-27-33-26-15-13-21-17-23(37)14-16-25(21)32(26)28(40-2)20-29(33)43-36(34(27)38)22-18-30(41-3)35(39)31(19-22)42-24-10-8-6-9-11-24/h14,16-20,24,27,34,36-39H,4-13,15H2,1-3H3 |
| InChIKey | YQKFDVCFIZBFOU-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|