C26H47N3O3 — CID 162833876
1-[2-[(1R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine (PubChem CID 162833876) has the molecular formula C26H47N3O3 and a molecular weight of 449.68 g/mol. Its IUPAC name is 1-[2-[(1R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine.
| Compound Name | 1-[2-[(1R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 162833876 |
| Molecular Formula | C26H47N3O3 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.36 |
| IUPAC Name | 1-[2-[(1R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine |
| SMILES | C=C(C1CCCCC1)[C@H]1CC[C@@](C)(O)[C@H]2CC[C@@](O)(CCN/C(=N/C)NCCCO)[C@H]2C1 |
| InChI | InChI=1S/C26H47N3O3/c1-19(20-8-5-4-6-9-20)21-10-12-25(2,31)22-11-13-26(32,23(22)18-21)14-16-29-24(27-3)28-15-7-17-30/h20-23,30-32H,1,4-18H2,2-3H3,(H2,27,28,29)/t21-,22-,23-,25+,26+/m0/s1 |
| InChIKey | LSYYDOLSUOZEAX-AZQMGYJQSA-N |
| XLogP | 3.37 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|