C40H46O7S2 — CID 162834531
9,30-dimethoxy-19-methyl-7-(3-methylbutoxy)-35-oxa-15,16-dithiaheptacyclo[20.10.2.14,32.02,14.05,10.023,28.029,33]pentatriaconta-1(33),5,7,9,23(28),24,26,29,31-nonaen-12-yne-3,8,25-triol (PubChem CID 162834531) has the molecular formula C40H46O7S2 and a molecular weight of 702.93 g/mol. Its IUPAC name is 9,30-dimethoxy-19-methyl-7-(3-methylbutoxy)-35-oxa-15,16-dithiaheptacyclo[20.10.2.14,32.02,14.05,10.023,28.029,33]pentatriaconta-1(33),5,7,9,23(28),24,26,29,31-nonaen-12-yne-3,8,25-triol.
| Compound Name | 9,30-dimethoxy-19-methyl-7-(3-methylbutoxy)-35-oxa-15,16-dithiaheptacyclo[20.10.2.14,32.02,14.05,10.023,28.029,33]pentatriaconta-1(33),5,7,9,23(28),24,26,29,31-nonaen-12-yne-3,8,25-triol |
|---|---|
| PubChem CID | 162834531 |
| Molecular Formula | C40H46O7S2 |
| Molecular Weight | 702.93 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | 9,30-dimethoxy-19-methyl-7-(3-methylbutoxy)-35-oxa-15,16-dithiaheptacyclo[20.10.2.14,32.02,14.05,10.023,28.029,33]pentatriaconta-1(33),5,7,9,23(28),24,26,29,31-nonaen-12-yne-3,8,25-triol |
| SMILES | COc1cc2c3c4c1-c1ccc(O)cc1C(CCC(C)CCSSC1C#CCc5c(cc(OCCC(C)C)c(O)c5OC)C(O2)C(O)C31)C4 |
| InChI | InChI=1S/C40H46O7S2/c1-21(2)13-15-46-32-19-28-26(39(45-5)37(32)42)7-6-8-33-36-35-29-17-23(10-9-22(3)14-16-48-49-33)27-18-24(41)11-12-25(27)34(29)30(44-4)20-31(35)47-40(28)38(36)43/h11-12,18-23,33,36,38,40-43H,7,9-10,13-17H2,1-5H3 |
| InChIKey | TWNDEBAHKGIRBP-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.93 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|