C22H39N3O2 — CID 162834766
1-[2-[7-(1-cyclopentylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine (PubChem CID 162834766) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is 1-[2-[7-(1-cyclopentylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[7-(1-cyclopentylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162834766 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | 1-[2-[7-(1-cyclopentylethenyl)-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
| SMILES | C=C(C1CCCC1)C1CCC(C)(O)C2CCC(O)(CCN/C(N)=N/C)C2C1 |
| InChI | InChI=1S/C22H39N3O2/c1-15(16-6-4-5-7-16)17-8-10-21(2,26)18-9-11-22(27,19(18)14-17)12-13-25-20(23)24-3/h16-19,26-27H,1,4-14H2,2-3H3,(H3,23,24,25) |
| InChIKey | GOHSWGBXIWFSMW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|