C20H38N4O2 — CID 162834789
1-[2-[1,4-dihydroxy-4-methyl-7-[4-(methylamino)but-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine (PubChem CID 162834789) has the molecular formula C20H38N4O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 1-[2-[1,4-dihydroxy-4-methyl-7-[4-(methylamino)but-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[1,4-dihydroxy-4-methyl-7-[4-(methylamino)but-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162834789 |
| Molecular Formula | C20H38N4O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | 1-[2-[1,4-dihydroxy-4-methyl-7-[4-(methylamino)but-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
| SMILES | C=C(CCNC)C1CCC(C)(O)C2CCC(O)(CCN/C(N)=N/C)C2C1 |
| InChI | InChI=1S/C20H38N4O2/c1-14(7-11-22-3)15-5-8-19(2,25)16-6-9-20(26,17(16)13-15)10-12-24-18(21)23-4/h15-17,22,25-26H,1,5-13H2,2-4H3,(H3,21,23,24) |
| InChIKey | LSSDGVDKBRWHLF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|