C42H58O5 — CID 162835863
6-[4-(3-cyclopentyl-3-methyloxiran-2-yl)-4-hydroxybutan-2-yl]-15-(3-hydroxyphenyl)-1,9,10,17,17-pentamethylpentacyclo[13.3.1.02,10.05,9.012,18]nonadec-5-ene-7,16-dione (PubChem CID 162835863) has the molecular formula C42H58O5 and a molecular weight of 642.92 g/mol. Its IUPAC name is 6-[4-(3-cyclopentyl-3-methyloxiran-2-yl)-4-hydroxybutan-2-yl]-15-(3-hydroxyphenyl)-1,9,10,17,17-pentamethylpentacyclo[13.3.1.02,10.05,9.012,18]nonadec-5-ene-7,16-dione.
| Compound Name | 6-[4-(3-cyclopentyl-3-methyloxiran-2-yl)-4-hydroxybutan-2-yl]-15-(3-hydroxyphenyl)-1,9,10,17,17-pentamethylpentacyclo[13.3.1.02,10.05,9.012,18]nonadec-5-ene-7,16-dione |
|---|---|
| PubChem CID | 162835863 |
| Molecular Formula | C42H58O5 |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.43 |
| IUPAC Name | 6-[4-(3-cyclopentyl-3-methyloxiran-2-yl)-4-hydroxybutan-2-yl]-15-(3-hydroxyphenyl)-1,9,10,17,17-pentamethylpentacyclo[13.3.1.02,10.05,9.012,18]nonadec-5-ene-7,16-dione |
| SMILES | CC(CC(O)C1OC1(C)C1CCCC1)C1=C2CCC3C4(C)CC5(c6cccc(O)c6)CCC(CC3(C)C2(C)CC1=O)C4C(C)(C)C5=O |
| InChI | InChI=1S/C42H58O5/c1-24(19-30(44)35-41(7,47-35)26-11-8-9-12-26)33-29-15-16-32-38(4)23-42(27-13-10-14-28(43)20-27)18-17-25(34(38)37(2,3)36(42)46)21-40(32,6)39(29,5)22-31(33)45/h10,13-14,20,24-26,30,32,34-35,43-44H,8-9,11-12,15-19,21-23H2,1-7H3 |
| InChIKey | DPYSXSHLPJXLFJ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|