C38H43NO8S2 — CID 162836097
[6-[3,4-dihydroxy-5-(2-pyridin-3-ylethoxy)phenyl]-23-hydroxy-5,21-dioxa-13,14-dithiapentacyclo[20.3.1.116,20.03,12.04,9]heptacosa-1(26),10,22,24-tetraen-8-yl] acetate (PubChem CID 162836097) has the molecular formula C38H43NO8S2 and a molecular weight of 705.90 g/mol. Its IUPAC name is [6-[3,4-dihydroxy-5-(2-pyridin-3-ylethoxy)phenyl]-23-hydroxy-5,21-dioxa-13,14-dithiapentacyclo[20.3.1.116,20.03,12.04,9]heptacosa-1(26),10,22,24-tetraen-8-yl] acetate.
| Compound Name | [6-[3,4-dihydroxy-5-(2-pyridin-3-ylethoxy)phenyl]-23-hydroxy-5,21-dioxa-13,14-dithiapentacyclo[20.3.1.116,20.03,12.04,9]heptacosa-1(26),10,22,24-tetraen-8-yl] acetate |
|---|---|
| PubChem CID | 162836097 |
| Molecular Formula | C38H43NO8S2 |
| Molecular Weight | 705.90 g/mol |
| Exact Mass | 705.24 |
| IUPAC Name | [6-[3,4-dihydroxy-5-(2-pyridin-3-ylethoxy)phenyl]-23-hydroxy-5,21-dioxa-13,14-dithiapentacyclo[20.3.1.116,20.03,12.04,9]heptacosa-1(26),10,22,24-tetraen-8-yl] acetate |
| SMILES | CC(=O)OC1CC(c2cc(O)c(O)c(OCCc3cccnc3)c2)OC2C1C=CC1SSCC3CCCC(C3)Oc3cc(ccc3O)CC12 |
| InChI | InChI=1S/C38H43NO8S2/c1-22(40)45-33-19-32(26-17-31(42)37(43)35(18-26)44-13-11-23-5-3-12-39-20-23)47-38-28(33)8-10-36-29(38)15-24-7-9-30(41)34(16-24)46-27-6-2-4-25(14-27)21-48-49-36/h3,5,7-10,12,16-18,20,25,27-29,32-33,36,38,41-43H,2,4,6,11,13-15,19,21H2,1H3 |
| InChIKey | HVPQVVHCBIQMRP-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.90 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|