C33H45NO — CID 162836197
3-[[(1R,3R)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[(1R,4S)-4-(ethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]phenol (PubChem CID 162836197) has the molecular formula C33H45NO and a molecular weight of 471.73 g/mol. Its IUPAC name is 3-[[(1R,3R)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[(1R,4S)-4-(ethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]phenol.
| Compound Name | 3-[[(1R,3R)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[(1R,4S)-4-(ethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]phenol |
|---|---|
| PubChem CID | 162836197 |
| Molecular Formula | C33H45NO |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | 3-[[(1R,3R)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[(1R,4S)-4-(ethylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]phenol |
| SMILES | CCN[C@H]1CC[C@H](c2cc(O)cc(C[C@@H]3CCC[C@@H]([C@@]4(C)C=CC[C@H](C)C4)C3)c2)c2ccccc21 |
| InChI | InChI=1S/C33H45NO/c1-4-34-32-15-14-29(30-12-5-6-13-31(30)32)26-18-25(20-28(35)21-26)17-24-10-7-11-27(19-24)33(3)16-8-9-23(2)22-33/h5-6,8,12-13,16,18,20-21,23-24,27,29,32,34-35H,4,7,9-11,14-15,17,19,22H2,1-3H3/t23-,24-,27+,29+,32-,33-/m0/s1 |
| InChIKey | OPOBLWJCCMLSTK-ZIQIXULKSA-N |
| XLogP | 8.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|