C25H29FN4O — CID 162836548
4-fluoro-N-[[4-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide (PubChem CID 162836548) has the molecular formula C25H29FN4O and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-fluoro-N-[[4-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[4-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 162836548 |
| Molecular Formula | C25H29FN4O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4-fluoro-N-[[4-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide |
| SMILES | CC1=CC(CNC(=O)c2ccc(F)cc2)C(C(C)C)CC1Cc1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C25H29FN4O/c1-15(2)21-11-18(12-24-29-22-8-9-27-14-23(22)30-24)16(3)10-19(21)13-28-25(31)17-4-6-20(26)7-5-17/h4-10,14-15,18-19,21H,11-13H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | WVDMINBHILGTIO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|